C22H26FNO4 — CID 51871457
[5-[[(3aR,7R,7aS)-7-(4-fluorophenyl)-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]methyl]furan-2-yl]methyl acetate (PubChem CID 51871457) has the molecular formula C22H26FNO4 and a molecular weight of 387.45 g/mol. Its IUPAC name is [5-[[(3aR,7R,7aS)-7-(4-fluorophenyl)-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]methyl]furan-2-yl]methyl acetate.
| Compound Name | [5-[[(3aR,7R,7aS)-7-(4-fluorophenyl)-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]methyl]furan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 51871457 |
| Molecular Formula | C22H26FNO4 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | [5-[[(3aR,7R,7aS)-7-(4-fluorophenyl)-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]methyl]furan-2-yl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(CN2C[C@@H]3CCC[C@](O)(c4ccc(F)cc4)[C@@H]3C2)o1 |
| InChI | InChI=1S/C22H26FNO4/c1-15(25)27-14-20-9-8-19(28-20)12-24-11-16-3-2-10-22(26,21(16)13-24)17-4-6-18(23)7-5-17/h4-9,16,21,26H,2-3,10-14H2,1H3/t16-,21+,22-/m0/s1 |
| InChIKey | WSMQRFJVQZNWBS-USCONSEESA-N |
| XLogP | 3.60 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |