C20H26N4O4S — CID 5187184
2-[[2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 5187184) has the molecular formula C20H26N4O4S and a molecular weight of 418.52 g/mol. Its IUPAC name is 2-[[2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 5187184 |
| Molecular Formula | C20H26N4O4S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 2-[[2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC1CCc2c(sc(NC(=O)CN3C(=O)NC4(CCCCC4)C3=O)c2C(N)=O)C1 |
| InChI | InChI=1S/C20H26N4O4S/c1-11-5-6-12-13(9-11)29-17(15(12)16(21)26)22-14(25)10-24-18(27)20(23-19(24)28)7-3-2-4-8-20/h11H,2-10H2,1H3,(H2,21,26)(H,22,25)(H,23,28) |
| InChIKey | SDDLYQCQBLYVKY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|