C18H22FN5O2 — CID 51871903
(4R,5S)-N-[(2R)-2-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3-(4-fluorophenyl)-4-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 51871903) has the molecular formula C18H22FN5O2 and a molecular weight of 359.41 g/mol. Its IUPAC name is (4R,5S)-N-[(2R)-2-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3-(4-fluorophenyl)-4-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | (4R,5S)-N-[(2R)-2-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3-(4-fluorophenyl)-4-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 51871903 |
| Molecular Formula | C18H22FN5O2 |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | (4R,5S)-N-[(2R)-2-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3-(4-fluorophenyl)-4-methyl-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | Cc1nc(C)n([C@H](C)CNC(=O)[C@H]2ON=C(c3ccc(F)cc3)[C@H]2C)n1 |
| InChI | InChI=1S/C18H22FN5O2/c1-10(24-13(4)21-12(3)22-24)9-20-18(25)17-11(2)16(23-26-17)14-5-7-15(19)8-6-14/h5-8,10-11,17H,9H2,1-4H3,(H,20,25)/t10-,11-,17+/m1/s1 |
| InChIKey | GSZWQJQJKWQNNB-AGKHESDQSA-N |
| XLogP | 2.15 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |