C18H17BrN2O4 — CID 51871982
1-(4-bromophenyl)-N-[(2S)-2-hydroxy-2-(4-nitrophenyl)ethyl]cyclopropane-1-carboxamide (PubChem CID 51871982) has the molecular formula C18H17BrN2O4 and a molecular weight of 405.25 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-[(2S)-2-hydroxy-2-(4-nitrophenyl)ethyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(4-bromophenyl)-N-[(2S)-2-hydroxy-2-(4-nitrophenyl)ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 51871982 |
| Molecular Formula | C18H17BrN2O4 |
| Molecular Weight | 405.25 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 1-(4-bromophenyl)-N-[(2S)-2-hydroxy-2-(4-nitrophenyl)ethyl]cyclopropane-1-carboxamide |
| SMILES | O=C(NC[C@@H](O)c1ccc([N+](=O)[O-])cc1)C1(c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C18H17BrN2O4/c19-14-5-3-13(4-6-14)18(9-10-18)17(23)20-11-16(22)12-1-7-15(8-2-12)21(24)25/h1-8,16,22H,9-11H2,(H,20,23)/t16-/m1/s1 |
| InChIKey | XCORCVFZXKCNKN-MRXNPFEDSA-N |
| XLogP | 3.24 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|