About 2-[2-ethylhexanoyl-[2-(2-ethylhexanoyloxy)ethyl]amino]ethyl 2-ethylhexanoate
2-[2-ethylhexanoyl-[2-(2-ethylhexanoyloxy)ethyl]amino]ethyl 2-ethylhexanoate (PubChem CID 518774) has the molecular formula C28H53NO5
and a molecular weight of 483.73 g/mol. Its IUPAC name is 2-[2-ethylhexanoyl-[2-(2-ethylhexanoyloxy)ethyl]amino]ethyl 2-ethylhexanoate.
Molecular Properties
| Compound Name | 2-[2-ethylhexanoyl-[2-(2-ethylhexanoyloxy)ethyl]amino]ethyl 2-ethylhexanoate |
| PubChem CID | 518774 |
| Molecular Formula | C28H53NO5 |
| Molecular Weight | 483.73 g/mol |
| Exact Mass | 483.39 |
| IUPAC Name | 2-[2-ethylhexanoyl-[2-(2-ethylhexanoyloxy)ethyl]amino]ethyl 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)OCCN(CCOC(=O)C(CC)CCCC)C(=O)C(CC)CCCC |
| InChI | InChI=1S/C28H53NO5/c1-7-13-16-23(10-4)26(30)29(19-21-33-27(31)24(11-5)17-14-8-2)20-22-34-28(32)25(12-6)18-15-9-3/h23-25H,7-22H2,1-6H3 |
| InChIKey | YYIIMEOVMYJQST-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.73 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-ethylhexanoyl-[2-(2-ethylhexanoyloxy)ethyl]amino]ethyl 2-ethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-ethylhexanoyl-[2-(2-ethylhexanoyloxy)ethyl]amino]ethyl 2-ethylhexanoate?
The IUPAC name of 2-[2-ethylhexanoyl-[2-(2-ethylhexanoyloxy)ethyl]amino]ethyl 2-ethylhexanoate (CID 518774) is 2-[2-ethylhexanoyl-[2-(2-ethylhexanoyloxy)ethyl]amino]ethyl 2-ethylhexanoate.
What is the SMILES notation for 2-[2-ethylhexanoyl-[2-(2-ethylhexanoyloxy)ethyl]amino]ethyl 2-ethylhexanoate?
The canonical SMILES for 2-[2-ethylhexanoyl-[2-(2-ethylhexanoyloxy)ethyl]amino]ethyl 2-ethylhexanoate is CCCCC(CC)C(=O)OCCN(CCOC(=O)C(CC)CCCC)C(=O)C(CC)CCCC.
What is the InChIKey of 2-[2-ethylhexanoyl-[2-(2-ethylhexanoyloxy)ethyl]amino]ethyl 2-ethylhexanoate?
The InChIKey is YYIIMEOVMYJQST-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H53NO5/c1-7-13-16-23(10-4)26(30)29(19-21-33-27(31)24(11-5)17-14-8-2)20-22-34-28(32)25(12-6)18-15-9-3/h23-25H,7-22H2,1-6H3.
What are the key properties of 2-[2-ethylhexanoyl-[2-(2-ethylhexanoyloxy)ethyl]amino]ethyl 2-ethylhexanoate?
2-[2-ethylhexanoyl-[2-(2-ethylhexanoyloxy)ethyl]amino]ethyl 2-ethylhexanoate has a molecular weight of 483.73 g/mol, XLogP of 6.55, 21 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-ethylhexanoyl-[2-(2-ethylhexanoyloxy)ethyl]amino]ethyl 2-ethylhexanoate is sourced from PubChem (CID 518774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).