C30H32N2O8S — CID 5187902
methyl 2-[2-(4-butoxy-3-ethoxyphenyl)-3-[hydroxy-(4-methoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 5187902) has the molecular formula C30H32N2O8S and a molecular weight of 580.66 g/mol. Its IUPAC name is methyl 2-[2-(4-butoxy-3-ethoxyphenyl)-3-[hydroxy-(4-methoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[2-(4-butoxy-3-ethoxyphenyl)-3-[hydroxy-(4-methoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 5187902 |
| Molecular Formula | C30H32N2O8S |
| Molecular Weight | 580.66 g/mol |
| Exact Mass | 580.19 |
| IUPAC Name | methyl 2-[2-(4-butoxy-3-ethoxyphenyl)-3-[hydroxy-(4-methoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCCCOc1ccc(C2C(=C(O)c3ccc(OC)cc3)C(=O)C(=O)N2c2nc(C)c(C(=O)OC)s2)cc1OCC |
| InChI | InChI=1S/C30H32N2O8S/c1-6-8-15-40-21-14-11-19(16-22(21)39-7-2)24-23(25(33)18-9-12-20(37-4)13-10-18)26(34)28(35)32(24)30-31-17(3)27(41-30)29(36)38-5/h9-14,16,24,33H,6-8,15H2,1-5H3 |
| InChIKey | CCPOWCCVGZFBOJ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 124.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.66 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|