About 4-amino-6-chloro-3-N-methylbenzene-1,3-disulfonamide
4-amino-6-chloro-3-N-methylbenzene-1,3-disulfonamide (PubChem CID 518797) has the molecular formula C7H10ClN3O4S2
and a molecular weight of 299.76 g/mol. Its IUPAC name is 4-amino-6-chloro-3-N-methylbenzene-1,3-disulfonamide.
Molecular Properties
| Compound Name | 4-amino-6-chloro-3-N-methylbenzene-1,3-disulfonamide |
| PubChem CID | 518797 |
| Molecular Formula | C7H10ClN3O4S2 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | 4-amino-6-chloro-3-N-methylbenzene-1,3-disulfonamide |
| SMILES | CNS(=O)(=O)c1cc(S(N)(=O)=O)c(Cl)cc1N |
| InChI | InChI=1S/C7H10ClN3O4S2/c1-11-17(14,15)7-3-6(16(10,12)13)4(8)2-5(7)9/h2-3,11H,9H2,1H3,(H2,10,12,13) |
| InChIKey | HZLMCYKKQJTLER-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-6-chloro-3-N-methylbenzene-1,3-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-6-chloro-3-N-methylbenzene-1,3-disulfonamide?
The IUPAC name of 4-amino-6-chloro-3-N-methylbenzene-1,3-disulfonamide (CID 518797) is 4-amino-6-chloro-3-N-methylbenzene-1,3-disulfonamide.
What is the SMILES notation for 4-amino-6-chloro-3-N-methylbenzene-1,3-disulfonamide?
The canonical SMILES for 4-amino-6-chloro-3-N-methylbenzene-1,3-disulfonamide is CNS(=O)(=O)c1cc(S(N)(=O)=O)c(Cl)cc1N.
What is the InChIKey of 4-amino-6-chloro-3-N-methylbenzene-1,3-disulfonamide?
The InChIKey is HZLMCYKKQJTLER-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClN3O4S2/c1-11-17(14,15)7-3-6(16(10,12)13)4(8)2-5(7)9/h2-3,11H,9H2,1H3,(H2,10,12,13).
What are the key properties of 4-amino-6-chloro-3-N-methylbenzene-1,3-disulfonamide?
4-amino-6-chloro-3-N-methylbenzene-1,3-disulfonamide has a molecular weight of 299.76 g/mol, XLogP of -0.52, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-6-chloro-3-N-methylbenzene-1,3-disulfonamide is sourced from PubChem (CID 518797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).