C15H17ClF3N3O — CID 51883684
2-[4-chloro-3-(trifluoromethyl)anilino]-N-[(2S)-2-cyano-3-methylbutan-2-yl]acetamide (PubChem CID 51883684) has the molecular formula C15H17ClF3N3O and a molecular weight of 347.77 g/mol. Its IUPAC name is 2-[4-chloro-3-(trifluoromethyl)anilino]-N-[(2S)-2-cyano-3-methylbutan-2-yl]acetamide.
| Compound Name | 2-[4-chloro-3-(trifluoromethyl)anilino]-N-[(2S)-2-cyano-3-methylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 51883684 |
| Molecular Formula | C15H17ClF3N3O |
| Molecular Weight | 347.77 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 2-[4-chloro-3-(trifluoromethyl)anilino]-N-[(2S)-2-cyano-3-methylbutan-2-yl]acetamide |
| SMILES | CC(C)[C@@](C)(C#N)NC(=O)CNc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H17ClF3N3O/c1-9(2)14(3,8-20)22-13(23)7-21-10-4-5-12(16)11(6-10)15(17,18)19/h4-6,9,21H,7H2,1-3H3,(H,22,23)/t14-/m1/s1 |
| InChIKey | DRLREVSELTUHIK-CQSZACIVSA-N |
| XLogP | 3.83 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.77 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |