About 3-(3-bromophenyl)-1,4-dicyclohexylpiperazine-2,5-dione
3-(3-bromophenyl)-1,4-dicyclohexylpiperazine-2,5-dione (PubChem CID 5188396) has the molecular formula C22H29BrN2O2
and a molecular weight of 433.39 g/mol. Its IUPAC name is 3-(3-bromophenyl)-1,4-dicyclohexylpiperazine-2,5-dione.
Molecular Properties
| Compound Name | 3-(3-bromophenyl)-1,4-dicyclohexylpiperazine-2,5-dione |
| PubChem CID | 5188396 |
| Molecular Formula | C22H29BrN2O2 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 3-(3-bromophenyl)-1,4-dicyclohexylpiperazine-2,5-dione |
| SMILES | O=C1C(c2cccc(Br)c2)N(C2CCCCC2)C(=O)CN1C1CCCCC1 |
| InChI | InChI=1S/C22H29BrN2O2/c23-17-9-7-8-16(14-17)21-22(27)24(18-10-3-1-4-11-18)15-20(26)25(21)19-12-5-2-6-13-19/h7-9,14,18-19,21H,1-6,10-13,15H2 |
| InChIKey | OHJDUEFROIFLDV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3-bromophenyl)-1,4-dicyclohexylpiperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-bromophenyl)-1,4-dicyclohexylpiperazine-2,5-dione?
The IUPAC name of 3-(3-bromophenyl)-1,4-dicyclohexylpiperazine-2,5-dione (CID 5188396) is 3-(3-bromophenyl)-1,4-dicyclohexylpiperazine-2,5-dione.
What is the SMILES notation for 3-(3-bromophenyl)-1,4-dicyclohexylpiperazine-2,5-dione?
The canonical SMILES for 3-(3-bromophenyl)-1,4-dicyclohexylpiperazine-2,5-dione is O=C1C(c2cccc(Br)c2)N(C2CCCCC2)C(=O)CN1C1CCCCC1.
What is the InChIKey of 3-(3-bromophenyl)-1,4-dicyclohexylpiperazine-2,5-dione?
The InChIKey is OHJDUEFROIFLDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29BrN2O2/c23-17-9-7-8-16(14-17)21-22(27)24(18-10-3-1-4-11-18)15-20(26)25(21)19-12-5-2-6-13-19/h7-9,14,18-19,21H,1-6,10-13,15H2.
What are the key properties of 3-(3-bromophenyl)-1,4-dicyclohexylpiperazine-2,5-dione?
3-(3-bromophenyl)-1,4-dicyclohexylpiperazine-2,5-dione has a molecular weight of 433.39 g/mol, XLogP of 4.83, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromophenyl)-1,4-dicyclohexylpiperazine-2,5-dione is sourced from PubChem (CID 5188396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).