C27H35N7O3 — CID 51886928
ethyl (3R)-1-[5,6-diamino-9-cyano-3-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-2-oxo-1H-pyrrolo[2,3-c][2,7]naphthyridin-8-yl]piperidine-3-carboxylate (PubChem CID 51886928) has the molecular formula C27H35N7O3 and a molecular weight of 505.62 g/mol. Its IUPAC name is ethyl (3R)-1-[5,6-diamino-9-cyano-3-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-2-oxo-1H-pyrrolo[2,3-c][2,7]naphthyridin-8-yl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[5,6-diamino-9-cyano-3-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-2-oxo-1H-pyrrolo[2,3-c][2,7]naphthyridin-8-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 51886928 |
| Molecular Formula | C27H35N7O3 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | ethyl (3R)-1-[5,6-diamino-9-cyano-3-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-2-oxo-1H-pyrrolo[2,3-c][2,7]naphthyridin-8-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(c2nc(N)c3c(N)nc4c(c3c2C#N)CC(=O)N4[C@@H]2CCCC(C)[C@@H]2C)C1 |
| InChI | InChI=1S/C27H35N7O3/c1-4-37-27(36)16-8-6-10-33(13-16)25-18(12-28)21-17-11-20(35)34(19-9-5-7-14(2)15(19)3)26(17)32-24(30)22(21)23(29)31-25/h14-16,19H,4-11,13H2,1-3H3,(H2,29,31)(H2,30,32)/t14?,15-,16+,19+/m0/s1 |
| InChIKey | DTDWXPNNZDAXHI-MYFLLLLCSA-N |
| XLogP | 3.16 |
| TPSA | 151.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |