C9H5BrF6 — CID 518871
1-(bromomethyl)-2,4-bis(trifluoromethyl)benzene (PubChem CID 518871) has the molecular formula C9H5BrF6 and a molecular weight of 307.03 g/mol. Its IUPAC name is 1-(bromomethyl)-2,4-bis(trifluoromethyl)benzene.
| Compound Name | 1-(bromomethyl)-2,4-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 518871 |
| Molecular Formula | C9H5BrF6 |
| Molecular Weight | 307.03 g/mol |
| Exact Mass | 305.95 |
| IUPAC Name | 1-(bromomethyl)-2,4-bis(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1ccc(CBr)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H5BrF6/c10-4-5-1-2-6(8(11,12)13)3-7(5)9(14,15)16/h1-3H,4H2 |
| InChIKey | SWFFFUJOWAJJCH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.03 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|