C13H11NO6S — CID 51887690
2-[(3R)-1,1-dioxothiolan-3-yl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 51887690) has the molecular formula C13H11NO6S and a molecular weight of 309.30 g/mol. Its IUPAC name is 2-[(3R)-1,1-dioxothiolan-3-yl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 51887690 |
| Molecular Formula | C13H11NO6S |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)N([C@@H]1CCS(=O)(=O)C1)C2=O |
| InChI | InChI=1S/C13H11NO6S/c15-11-9-2-1-7(13(17)18)5-10(9)12(16)14(11)8-3-4-21(19,20)6-8/h1-2,5,8H,3-4,6H2,(H,17,18)/t8-/m1/s1 |
| InChIKey | IABZZPAAVQPBGD-MRVPVSSYSA-N |
| XLogP | 0.17 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|