About 2,5-dibromo-N,N-bis(prop-2-enyl)benzenesulfonamide
2,5-dibromo-N,N-bis(prop-2-enyl)benzenesulfonamide (PubChem CID 51888305) has the molecular formula C12H13Br2NO2S
and a molecular weight of 395.12 g/mol. Its IUPAC name is 2,5-dibromo-N,N-bis(prop-2-enyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 2,5-dibromo-N,N-bis(prop-2-enyl)benzenesulfonamide |
| PubChem CID | 51888305 |
| Molecular Formula | C12H13Br2NO2S |
| Molecular Weight | 395.12 g/mol |
| Exact Mass | 392.90 |
| IUPAC Name | 2,5-dibromo-N,N-bis(prop-2-enyl)benzenesulfonamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C12H13Br2NO2S/c1-3-7-15(8-4-2)18(16,17)12-9-10(13)5-6-11(12)14/h3-6,9H,1-2,7-8H2 |
| InChIKey | XYCUVFSYBZOXIG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.12 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dibromo-N,N-bis(prop-2-enyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dibromo-N,N-bis(prop-2-enyl)benzenesulfonamide?
The IUPAC name of 2,5-dibromo-N,N-bis(prop-2-enyl)benzenesulfonamide (CID 51888305) is 2,5-dibromo-N,N-bis(prop-2-enyl)benzenesulfonamide.
What is the SMILES notation for 2,5-dibromo-N,N-bis(prop-2-enyl)benzenesulfonamide?
The canonical SMILES for 2,5-dibromo-N,N-bis(prop-2-enyl)benzenesulfonamide is C=CCN(CC=C)S(=O)(=O)c1cc(Br)ccc1Br.
What is the InChIKey of 2,5-dibromo-N,N-bis(prop-2-enyl)benzenesulfonamide?
The InChIKey is XYCUVFSYBZOXIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Br2NO2S/c1-3-7-15(8-4-2)18(16,17)12-9-10(13)5-6-11(12)14/h3-6,9H,1-2,7-8H2.
What are the key properties of 2,5-dibromo-N,N-bis(prop-2-enyl)benzenesulfonamide?
2,5-dibromo-N,N-bis(prop-2-enyl)benzenesulfonamide has a molecular weight of 395.12 g/mol, XLogP of 3.57, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dibromo-N,N-bis(prop-2-enyl)benzenesulfonamide is sourced from PubChem (CID 51888305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).