C44H28N4Ni — CID 518894
nickel;5,10,15,20-tetraphenylporphyrin (PubChem CID 518894) has the molecular formula C44H28N4Ni and a molecular weight of 671.43 g/mol. Its IUPAC name is nickel;5,10,15,20-tetraphenylporphyrin.
| Compound Name | nickel;5,10,15,20-tetraphenylporphyrin |
|---|---|
| PubChem CID | 518894 |
| Molecular Formula | C44H28N4Ni |
| Molecular Weight | 671.43 g/mol |
| Exact Mass | 670.17 |
| IUPAC Name | nickel;5,10,15,20-tetraphenylporphyrin |
| SMILES | C1=C/C2=C(\c3ccccc3)C3=N/C(=C(c4ccccc4)\C4=N/C(=C(/c5ccccc5)C5=N/C(=C(/c6ccccc6)C1=N2)C=C5)C=C4)C=C3.[Ni] |
| InChI | InChI=1S/C44H28N4.Ni/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36;/h1-28H;/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-; |
| InChIKey | QJFZOVVQYZDMOR-DAJBKUBHSA-N |
| XLogP | 9.69 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.43 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |