About 1-(2,4,5-trichlorophenyl)ethanol
1-(2,4,5-trichlorophenyl)ethanol (PubChem CID 518920) has the molecular formula C8H7Cl3O
and a molecular weight of 225.50 g/mol. Its IUPAC name is 1-(2,4,5-trichlorophenyl)ethanol.
Molecular Properties
| Compound Name | 1-(2,4,5-trichlorophenyl)ethanol |
| PubChem CID | 518920 |
| Molecular Formula | C8H7Cl3O |
| Molecular Weight | 225.50 g/mol |
| Exact Mass | 223.96 |
| IUPAC Name | 1-(2,4,5-trichlorophenyl)ethanol |
| SMILES | CC(O)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C8H7Cl3O/c1-4(12)5-2-7(10)8(11)3-6(5)9/h2-4,12H,1H3 |
| InChIKey | CZTWWYRPCFIOMY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,4,5-trichlorophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4,5-trichlorophenyl)ethanol?
The IUPAC name of 1-(2,4,5-trichlorophenyl)ethanol (CID 518920) is 1-(2,4,5-trichlorophenyl)ethanol.
What is the SMILES notation for 1-(2,4,5-trichlorophenyl)ethanol?
The canonical SMILES for 1-(2,4,5-trichlorophenyl)ethanol is CC(O)c1cc(Cl)c(Cl)cc1Cl.
What is the InChIKey of 1-(2,4,5-trichlorophenyl)ethanol?
The InChIKey is CZTWWYRPCFIOMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Cl3O/c1-4(12)5-2-7(10)8(11)3-6(5)9/h2-4,12H,1H3.
What are the key properties of 1-(2,4,5-trichlorophenyl)ethanol?
1-(2,4,5-trichlorophenyl)ethanol has a molecular weight of 225.50 g/mol, XLogP of 3.70, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4,5-trichlorophenyl)ethanol is sourced from PubChem (CID 518920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).