C27H32N2O8 — CID 5189206
4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-[3-(dimethylamino)propyl]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 5189206) has the molecular formula C27H32N2O8 and a molecular weight of 512.56 g/mol. Its IUPAC name is 4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-[3-(dimethylamino)propyl]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-[3-(dimethylamino)propyl]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 5189206 |
| Molecular Formula | C27H32N2O8 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-[3-(dimethylamino)propyl]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(C2C(=C(O)c3ccc4c(c3)OCCO4)C(=O)C(=O)N2CCCN(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C27H32N2O8/c1-28(2)9-6-10-29-23(17-14-20(33-3)26(35-5)21(15-17)34-4)22(25(31)27(29)32)24(30)16-7-8-18-19(13-16)37-12-11-36-18/h7-8,13-15,23,30H,6,9-12H2,1-5H3 |
| InChIKey | HLLVGAPJVRWWMQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|