C22H27N3O3 — CID 5189380
N-(4-methylphenyl)-N'-[[4-(2-methylpropoxy)phenyl]methylideneamino]butanediamide (PubChem CID 5189380) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-(4-methylphenyl)-N'-[[4-(2-methylpropoxy)phenyl]methylideneamino]butanediamide.
| Compound Name | N-(4-methylphenyl)-N'-[[4-(2-methylpropoxy)phenyl]methylideneamino]butanediamide |
|---|---|
| PubChem CID | 5189380 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N-(4-methylphenyl)-N'-[[4-(2-methylpropoxy)phenyl]methylideneamino]butanediamide |
| SMILES | Cc1ccc(NC(=O)CCC(=O)NN=Cc2ccc(OCC(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H27N3O3/c1-16(2)15-28-20-10-6-18(7-11-20)14-23-25-22(27)13-12-21(26)24-19-8-4-17(3)5-9-19/h4-11,14,16H,12-13,15H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | UBBQIZADARGYES-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|