C22H23ClN6OS — CID 51893958
N-[(2-chlorophenyl)methyl]-2-[(11-phenyl-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl)sulfanyl]acetamide (PubChem CID 51893958) has the molecular formula C22H23ClN6OS and a molecular weight of 454.99 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-[(11-phenyl-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl)sulfanyl]acetamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-[(11-phenyl-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 51893958 |
| Molecular Formula | C22H23ClN6OS |
| Molecular Weight | 454.99 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-[(11-phenyl-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl)sulfanyl]acetamide |
| SMILES | O=C(CSC1=NNC2C3CC(c4ccccc4)NN3C=CN12)NCc1ccccc1Cl |
| InChI | InChI=1S/C22H23ClN6OS/c23-17-9-5-4-8-16(17)13-24-20(30)14-31-22-26-25-21-19-12-18(15-6-2-1-3-7-15)27-29(19)11-10-28(21)22/h1-11,18-19,21,25,27H,12-14H2,(H,24,30) |
| InChIKey | SBNMHGYFKRUBEU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.99 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |