C19H19FN4OS — CID 51894721
2-fluoro-N-[(1R)-2-methyl-1-(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)propyl]benzamide (PubChem CID 51894721) has the molecular formula C19H19FN4OS and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-fluoro-N-[(1R)-2-methyl-1-(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)propyl]benzamide.
| Compound Name | 2-fluoro-N-[(1R)-2-methyl-1-(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)propyl]benzamide |
|---|---|
| PubChem CID | 51894721 |
| Molecular Formula | C19H19FN4OS |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 2-fluoro-N-[(1R)-2-methyl-1-(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)propyl]benzamide |
| SMILES | CC(C)[C@@H](NC(=O)c1ccccc1F)c1n[nH]c(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C19H19FN4OS/c1-12(2)16(21-18(25)14-10-6-7-11-15(14)20)17-22-23-19(26)24(17)13-8-4-3-5-9-13/h3-12,16H,1-2H3,(H,21,25)(H,23,26)/t16-/m1/s1 |
| InChIKey | WJUJUSZMSJTBKZ-MRXNPFEDSA-N |
| XLogP | 4.20 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|