About 1-butyladamantane
1-butyladamantane (PubChem CID 518949) has the molecular formula C14H24
and a molecular weight of 192.35 g/mol. Its IUPAC name is 1-butyladamantane.
Molecular Properties
| Compound Name | 1-butyladamantane |
| PubChem CID | 518949 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 1-butyladamantane |
| SMILES | CCCCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C14H24/c1-2-3-4-14-8-11-5-12(9-14)7-13(6-11)10-14/h11-13H,2-10H2,1H3 |
| InChIKey | AZCUIXHZJHFUFI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-butyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyladamantane?
The IUPAC name of 1-butyladamantane (CID 518949) is 1-butyladamantane.
What is the SMILES notation for 1-butyladamantane?
The canonical SMILES for 1-butyladamantane is CCCCC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-butyladamantane?
The InChIKey is AZCUIXHZJHFUFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24/c1-2-3-4-14-8-11-5-12(9-14)7-13(6-11)10-14/h11-13H,2-10H2,1H3.
What are the key properties of 1-butyladamantane?
1-butyladamantane has a molecular weight of 192.35 g/mol, XLogP of 4.39, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyladamantane is sourced from PubChem (CID 518949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).