About 1-butan-2-yladamantane
1-butan-2-yladamantane (PubChem CID 518950) has the molecular formula C14H24
and a molecular weight of 192.35 g/mol. Its IUPAC name is 1-butan-2-yladamantane.
Molecular Properties
| Compound Name | 1-butan-2-yladamantane |
| PubChem CID | 518950 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 1-butan-2-yladamantane |
| SMILES | CCC(C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C14H24/c1-3-10(2)14-7-11-4-12(8-14)6-13(5-11)9-14/h10-13H,3-9H2,1-2H3 |
| InChIKey | JEURJPFZYYKZIK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-butan-2-yladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yladamantane?
The IUPAC name of 1-butan-2-yladamantane (CID 518950) is 1-butan-2-yladamantane.
What is the SMILES notation for 1-butan-2-yladamantane?
The canonical SMILES for 1-butan-2-yladamantane is CCC(C)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-butan-2-yladamantane?
The InChIKey is JEURJPFZYYKZIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24/c1-3-10(2)14-7-11-4-12(8-14)6-13(5-11)9-14/h10-13H,3-9H2,1-2H3.
What are the key properties of 1-butan-2-yladamantane?
1-butan-2-yladamantane has a molecular weight of 192.35 g/mol, XLogP of 4.25, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yladamantane is sourced from PubChem (CID 518950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).