About 2-propyladamantane
2-propyladamantane (PubChem CID 518952) has the molecular formula C13H22
and a molecular weight of 178.32 g/mol. Its IUPAC name is 2-propyladamantane.
Molecular Properties
| Compound Name | 2-propyladamantane |
| PubChem CID | 518952 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 2-propyladamantane |
| SMILES | CCCC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C13H22/c1-2-3-13-11-5-9-4-10(7-11)8-12(13)6-9/h9-13H,2-8H2,1H3 |
| InChIKey | HMUYSRNQYPLWHB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-propyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyladamantane?
The IUPAC name of 2-propyladamantane (CID 518952) is 2-propyladamantane.
What is the SMILES notation for 2-propyladamantane?
The canonical SMILES for 2-propyladamantane is CCCC1C2CC3CC(C2)CC1C3.
What is the InChIKey of 2-propyladamantane?
The InChIKey is HMUYSRNQYPLWHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22/c1-2-3-13-11-5-9-4-10(7-11)8-12(13)6-9/h9-13H,2-8H2,1H3.
What are the key properties of 2-propyladamantane?
2-propyladamantane has a molecular weight of 178.32 g/mol, XLogP of 3.86, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyladamantane is sourced from PubChem (CID 518952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).