About 4-(1,2,4-triazol-4-yl)piperidin-1-ium
4-(1,2,4-triazol-4-yl)piperidin-1-ium (PubChem CID 51898081) has the molecular formula C7H13N4+
and a molecular weight of 153.21 g/mol. Its IUPAC name is 4-(1,2,4-triazol-4-yl)piperidin-1-ium.
Molecular Properties
| Compound Name | 4-(1,2,4-triazol-4-yl)piperidin-1-ium |
| PubChem CID | 51898081 |
| Molecular Formula | C7H13N4+ |
| Molecular Weight | 153.21 g/mol |
| Exact Mass | 153.11 |
| IUPAC Name | 4-(1,2,4-triazol-4-yl)piperidin-1-ium |
| SMILES | c1nncn1C1CC[NH2+]CC1 |
| InChI | InChI=1S/C7H12N4/c1-3-8-4-2-7(1)11-5-9-10-6-11/h5-8H,1-4H2/p+1 |
| InChIKey | OQHDZWPNEOFLCW-UHFFFAOYSA-O |
| XLogP | -0.82 |
| TPSA | 47.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.21 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1,2,4-triazol-4-yl)piperidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,2,4-triazol-4-yl)piperidin-1-ium?
The IUPAC name of 4-(1,2,4-triazol-4-yl)piperidin-1-ium (CID 51898081) is 4-(1,2,4-triazol-4-yl)piperidin-1-ium.
What is the SMILES notation for 4-(1,2,4-triazol-4-yl)piperidin-1-ium?
The canonical SMILES for 4-(1,2,4-triazol-4-yl)piperidin-1-ium is c1nncn1C1CC[NH2+]CC1.
What is the InChIKey of 4-(1,2,4-triazol-4-yl)piperidin-1-ium?
The InChIKey is OQHDZWPNEOFLCW-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H12N4/c1-3-8-4-2-7(1)11-5-9-10-6-11/h5-8H,1-4H2/p+1.
What are the key properties of 4-(1,2,4-triazol-4-yl)piperidin-1-ium?
4-(1,2,4-triazol-4-yl)piperidin-1-ium has a molecular weight of 153.21 g/mol, XLogP of -0.82, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2,4-triazol-4-yl)piperidin-1-ium is sourced from PubChem (CID 51898081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).