About 4-Acetamido-TEMPO
4-Acetamido-TEMPO (PubChem CID 518988) has the molecular formula C11H21N2O2
and a molecular weight of 213.30 g/mol.
Molecular Properties
| Compound Name | 4-Acetamido-TEMPO |
| PubChem CID | 518988 |
| Molecular Formula | C11H21N2O2 |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | — |
| SMILES | CC(=O)NC1CC(C)(C)N([O])C(C)(C)C1 |
| InChI | InChI=1S/C11H21N2O2/c1-8(14)12-9-6-10(2,3)13(15)11(4,5)7-9/h9H,6-7H2,1-5H3,(H,12,14) |
| InChIKey | UXBLSWOMIHTQPH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 52.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-Acetamido-TEMPO with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-Acetamido-TEMPO?
The IUPAC name of 4-Acetamido-TEMPO (CID 518988) is not available.
What is the SMILES notation for 4-Acetamido-TEMPO?
The canonical SMILES for 4-Acetamido-TEMPO is CC(=O)NC1CC(C)(C)N([O])C(C)(C)C1.
What is the InChIKey of 4-Acetamido-TEMPO?
The InChIKey is UXBLSWOMIHTQPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N2O2/c1-8(14)12-9-6-10(2,3)13(15)11(4,5)7-9/h9H,6-7H2,1-5H3,(H,12,14).
What are the key properties of 4-Acetamido-TEMPO?
4-Acetamido-TEMPO has a molecular weight of 213.30 g/mol, XLogP of 1.49, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-Acetamido-TEMPO is sourced from PubChem (CID 518988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).