C15H12Br2ClNO2 — CID 5189907
2-(3-chlorophenoxy)-N-(2,4-dibromophenyl)propanamide (PubChem CID 5189907) has the molecular formula C15H12Br2ClNO2 and a molecular weight of 433.53 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-(2,4-dibromophenyl)propanamide.
| Compound Name | 2-(3-chlorophenoxy)-N-(2,4-dibromophenyl)propanamide |
|---|---|
| PubChem CID | 5189907 |
| Molecular Formula | C15H12Br2ClNO2 |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 430.89 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-(2,4-dibromophenyl)propanamide |
| SMILES | CC(Oc1cccc(Cl)c1)C(=O)Nc1ccc(Br)cc1Br |
| InChI | InChI=1S/C15H12Br2ClNO2/c1-9(21-12-4-2-3-11(18)8-12)15(20)19-14-6-5-10(16)7-13(14)17/h2-9H,1H3,(H,19,20) |
| InChIKey | BVQMNRCKOJLIOI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |