C28H26ClN3O2S — CID 5189913
N-(3-carbamoyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2-(4-chlorophenyl)-3-methylquinoline-4-carboxamide (PubChem CID 5189913) has the molecular formula C28H26ClN3O2S and a molecular weight of 504.06 g/mol. Its IUPAC name is N-(3-carbamoyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2-(4-chlorophenyl)-3-methylquinoline-4-carboxamide.
| Compound Name | N-(3-carbamoyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2-(4-chlorophenyl)-3-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 5189913 |
| Molecular Formula | C28H26ClN3O2S |
| Molecular Weight | 504.06 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | N-(3-carbamoyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2-(4-chlorophenyl)-3-methylquinoline-4-carboxamide |
| SMILES | Cc1c(-c2ccc(Cl)cc2)nc2ccccc2c1C(=O)Nc1sc2c(c1C(N)=O)CCCCCC2 |
| InChI | InChI=1S/C28H26ClN3O2S/c1-16-23(19-8-6-7-10-21(19)31-25(16)17-12-14-18(29)15-13-17)27(34)32-28-24(26(30)33)20-9-4-2-3-5-11-22(20)35-28/h6-8,10,12-15H,2-5,9,11H2,1H3,(H2,30,33)(H,32,34) |
| InChIKey | APYXXKQPPOIWNL-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.06 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |