About (1R,5S)-6,6-difluoro-3-azabicyclo[3.1.0]hexane
(1R,5S)-6,6-difluoro-3-azabicyclo[3.1.0]hexane (PubChem CID 51900833) has the molecular formula C5H7F2N
and a molecular weight of 119.11 g/mol. Its IUPAC name is (1R,5S)-6,6-difluoro-3-azabicyclo[3.1.0]hexane.
Molecular Properties
| Compound Name | (1R,5S)-6,6-difluoro-3-azabicyclo[3.1.0]hexane |
| PubChem CID | 51900833 |
| Molecular Formula | C5H7F2N |
| Molecular Weight | 119.11 g/mol |
| Exact Mass | 119.05 |
| IUPAC Name | (1R,5S)-6,6-difluoro-3-azabicyclo[3.1.0]hexane |
| SMILES | FC1(F)[C@@H]2CNC[C@@H]21 |
| InChI | InChI=1S/C5H7F2N/c6-5(7)3-1-8-2-4(3)5/h3-4,8H,1-2H2/t3-,4+ |
| InChIKey | GHBUVDSNXSMDMM-ZXZARUISSA-N |
| XLogP | 0.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.11 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R,5S)-6,6-difluoro-3-azabicyclo[3.1.0]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5S)-6,6-difluoro-3-azabicyclo[3.1.0]hexane?
The IUPAC name of (1R,5S)-6,6-difluoro-3-azabicyclo[3.1.0]hexane (CID 51900833) is (1R,5S)-6,6-difluoro-3-azabicyclo[3.1.0]hexane.
What is the SMILES notation for (1R,5S)-6,6-difluoro-3-azabicyclo[3.1.0]hexane?
The canonical SMILES for (1R,5S)-6,6-difluoro-3-azabicyclo[3.1.0]hexane is FC1(F)[C@@H]2CNC[C@@H]21.
What is the InChIKey of (1R,5S)-6,6-difluoro-3-azabicyclo[3.1.0]hexane?
The InChIKey is GHBUVDSNXSMDMM-ZXZARUISSA-N. The full InChI is InChI=1S/C5H7F2N/c6-5(7)3-1-8-2-4(3)5/h3-4,8H,1-2H2/t3-,4+.
What are the key properties of (1R,5S)-6,6-difluoro-3-azabicyclo[3.1.0]hexane?
(1R,5S)-6,6-difluoro-3-azabicyclo[3.1.0]hexane has a molecular weight of 119.11 g/mol, XLogP of 0.47, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5S)-6,6-difluoro-3-azabicyclo[3.1.0]hexane is sourced from PubChem (CID 51900833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).