About 2-(1,3-benzodioxol-5-yl)-6-chloroimidazo[1,2-a]pyridine
2-(1,3-benzodioxol-5-yl)-6-chloroimidazo[1,2-a]pyridine (PubChem CID 5190275) has the molecular formula C14H9ClN2O2
and a molecular weight of 272.69 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-6-chloroimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 2-(1,3-benzodioxol-5-yl)-6-chloroimidazo[1,2-a]pyridine |
| PubChem CID | 5190275 |
| Molecular Formula | C14H9ClN2O2 |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-6-chloroimidazo[1,2-a]pyridine |
| SMILES | Clc1ccc2nc(-c3ccc4c(c3)OCO4)cn2c1 |
| InChI | InChI=1S/C14H9ClN2O2/c15-10-2-4-14-16-11(7-17(14)6-10)9-1-3-12-13(5-9)19-8-18-12/h1-7H,8H2 |
| InChIKey | AWNGFBUYGOWSNY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,3-benzodioxol-5-yl)-6-chloroimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzodioxol-5-yl)-6-chloroimidazo[1,2-a]pyridine?
The IUPAC name of 2-(1,3-benzodioxol-5-yl)-6-chloroimidazo[1,2-a]pyridine (CID 5190275) is 2-(1,3-benzodioxol-5-yl)-6-chloroimidazo[1,2-a]pyridine.
What is the SMILES notation for 2-(1,3-benzodioxol-5-yl)-6-chloroimidazo[1,2-a]pyridine?
The canonical SMILES for 2-(1,3-benzodioxol-5-yl)-6-chloroimidazo[1,2-a]pyridine is Clc1ccc2nc(-c3ccc4c(c3)OCO4)cn2c1.
What is the InChIKey of 2-(1,3-benzodioxol-5-yl)-6-chloroimidazo[1,2-a]pyridine?
The InChIKey is AWNGFBUYGOWSNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9ClN2O2/c15-10-2-4-14-16-11(7-17(14)6-10)9-1-3-12-13(5-9)19-8-18-12/h1-7H,8H2.
What are the key properties of 2-(1,3-benzodioxol-5-yl)-6-chloroimidazo[1,2-a]pyridine?
2-(1,3-benzodioxol-5-yl)-6-chloroimidazo[1,2-a]pyridine has a molecular weight of 272.69 g/mol, XLogP of 3.38, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzodioxol-5-yl)-6-chloroimidazo[1,2-a]pyridine is sourced from PubChem (CID 5190275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).