C26H27N5O3S — CID 5191568
2-[[7-(4-methoxyphenyl)-11,11-dimethyl-12-oxa-3,4,6,8-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-5-yl]sulfanyl]-N-phenylpropanamide (PubChem CID 5191568) has the molecular formula C26H27N5O3S and a molecular weight of 489.60 g/mol. Its IUPAC name is 2-[[7-(4-methoxyphenyl)-11,11-dimethyl-12-oxa-3,4,6,8-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-5-yl]sulfanyl]-N-phenylpropanamide.
| Compound Name | 2-[[7-(4-methoxyphenyl)-11,11-dimethyl-12-oxa-3,4,6,8-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-5-yl]sulfanyl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 5191568 |
| Molecular Formula | C26H27N5O3S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 2-[[7-(4-methoxyphenyl)-11,11-dimethyl-12-oxa-3,4,6,8-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-5-yl]sulfanyl]-N-phenylpropanamide |
| SMILES | COc1ccc(-c2nc3c(c4nnc(SC(C)C(=O)Nc5ccccc5)n24)COC(C)(C)C3)cc1 |
| InChI | InChI=1S/C26H27N5O3S/c1-16(24(32)27-18-8-6-5-7-9-18)35-25-30-29-23-20-15-34-26(2,3)14-21(20)28-22(31(23)25)17-10-12-19(33-4)13-11-17/h5-13,16H,14-15H2,1-4H3,(H,27,32) |
| InChIKey | QQJQGIKESWOAHO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |