C9H16NO5- — CID 5191579
3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoate (PubChem CID 5191579) has the molecular formula C9H16NO5- and a molecular weight of 218.23 g/mol. Its IUPAC name is 3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoate.
| Compound Name | 3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoate |
|---|---|
| PubChem CID | 5191579 |
| Molecular Formula | C9H16NO5- |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoate |
| SMILES | CC(C)(CO)C(O)C(=O)NCCC(=O)[O-] |
| InChI | InChI=1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13)/p-1 |
| InChIKey | GHOKWGTUZJEAQD-UHFFFAOYSA-M |
| XLogP | -2.38 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |