About 1,2-dimethylcyclobutane
1,2-dimethylcyclobutane (PubChem CID 519161) has the molecular formula C6H12
and a molecular weight of 84.16 g/mol. Its IUPAC name is 1,2-dimethylcyclobutane.
Molecular Properties
| Compound Name | 1,2-dimethylcyclobutane |
| PubChem CID | 519161 |
| Molecular Formula | C6H12 |
| Molecular Weight | 84.16 g/mol |
| Exact Mass | 84.09 |
| IUPAC Name | 1,2-dimethylcyclobutane |
| SMILES | CC1CCC1C |
| InChI | InChI=1S/C6H12/c1-5-3-4-6(5)2/h5-6H,3-4H2,1-2H3 |
| InChIKey | IVAGOJQDJFWIRT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 84.16 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-dimethylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylcyclobutane?
The IUPAC name of 1,2-dimethylcyclobutane (CID 519161) is 1,2-dimethylcyclobutane.
What is the SMILES notation for 1,2-dimethylcyclobutane?
The canonical SMILES for 1,2-dimethylcyclobutane is CC1CCC1C.
What is the InChIKey of 1,2-dimethylcyclobutane?
The InChIKey is IVAGOJQDJFWIRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12/c1-5-3-4-6(5)2/h5-6H,3-4H2,1-2H3.
What are the key properties of 1,2-dimethylcyclobutane?
1,2-dimethylcyclobutane has a molecular weight of 84.16 g/mol, XLogP of 2.05, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylcyclobutane is sourced from PubChem (CID 519161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).