About 2-methyl-5-propylfuran
2-methyl-5-propylfuran (PubChem CID 5191689) has the molecular formula C8H12O
and a molecular weight of 124.18 g/mol. Its IUPAC name is 2-methyl-5-propylfuran.
Molecular Properties
| Compound Name | 2-methyl-5-propylfuran |
| PubChem CID | 5191689 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | 2-methyl-5-propylfuran |
| SMILES | CCCc1ccc(C)o1 |
| InChI | InChI=1S/C8H12O/c1-3-4-8-6-5-7(2)9-8/h5-6H,3-4H2,1-2H3 |
| InChIKey | XPYQVFYTBQVKIS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-5-propylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-propylfuran?
The IUPAC name of 2-methyl-5-propylfuran (CID 5191689) is 2-methyl-5-propylfuran.
What is the SMILES notation for 2-methyl-5-propylfuran?
The canonical SMILES for 2-methyl-5-propylfuran is CCCc1ccc(C)o1.
What is the InChIKey of 2-methyl-5-propylfuran?
The InChIKey is XPYQVFYTBQVKIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O/c1-3-4-8-6-5-7(2)9-8/h5-6H,3-4H2,1-2H3.
What are the key properties of 2-methyl-5-propylfuran?
2-methyl-5-propylfuran has a molecular weight of 124.18 g/mol, XLogP of 2.54, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-propylfuran is sourced from PubChem (CID 5191689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).