C9H24O3Si3 — CID 519190
2,4,6-triethyl-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 519190) has the molecular formula C9H24O3Si3 and a molecular weight of 264.55 g/mol. Its IUPAC name is 2,4,6-triethyl-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2,4,6-triethyl-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 519190 |
| Molecular Formula | C9H24O3Si3 |
| Molecular Weight | 264.55 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2,4,6-triethyl-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | CC[Si]1(C)O[Si](C)(CC)O[Si](C)(CC)O1 |
| InChI | InChI=1S/C9H24O3Si3/c1-7-13(4)10-14(5,8-2)12-15(6,9-3)11-13/h7-9H2,1-6H3 |
| InChIKey | DGLJYEKNUTVPAE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|