About (2S)-3-amino-1,1,1-trifluoro-2-(1-methylpyrrol-3-yl)propan-2-ol
(2S)-3-amino-1,1,1-trifluoro-2-(1-methylpyrrol-3-yl)propan-2-ol (PubChem CID 51922092) has the molecular formula C8H11F3N2O
and a molecular weight of 208.18 g/mol. Its IUPAC name is (2S)-3-amino-1,1,1-trifluoro-2-(1-methylpyrrol-3-yl)propan-2-ol.
Molecular Properties
| Compound Name | (2S)-3-amino-1,1,1-trifluoro-2-(1-methylpyrrol-3-yl)propan-2-ol |
| PubChem CID | 51922092 |
| Molecular Formula | C8H11F3N2O |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | (2S)-3-amino-1,1,1-trifluoro-2-(1-methylpyrrol-3-yl)propan-2-ol |
| SMILES | Cn1ccc([C@](O)(CN)C(F)(F)F)c1 |
| InChI | InChI=1S/C8H11F3N2O/c1-13-3-2-6(4-13)7(14,5-12)8(9,10)11/h2-4,14H,5,12H2,1H3/t7-/m1/s1 |
| InChIKey | FMIJGJPKKYINBJ-SSDOTTSWSA-N |
| XLogP | 0.73 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-3-amino-1,1,1-trifluoro-2-(1-methylpyrrol-3-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-amino-1,1,1-trifluoro-2-(1-methylpyrrol-3-yl)propan-2-ol?
The IUPAC name of (2S)-3-amino-1,1,1-trifluoro-2-(1-methylpyrrol-3-yl)propan-2-ol (CID 51922092) is (2S)-3-amino-1,1,1-trifluoro-2-(1-methylpyrrol-3-yl)propan-2-ol.
What is the SMILES notation for (2S)-3-amino-1,1,1-trifluoro-2-(1-methylpyrrol-3-yl)propan-2-ol?
The canonical SMILES for (2S)-3-amino-1,1,1-trifluoro-2-(1-methylpyrrol-3-yl)propan-2-ol is Cn1ccc([C@](O)(CN)C(F)(F)F)c1.
What is the InChIKey of (2S)-3-amino-1,1,1-trifluoro-2-(1-methylpyrrol-3-yl)propan-2-ol?
The InChIKey is FMIJGJPKKYINBJ-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H11F3N2O/c1-13-3-2-6(4-13)7(14,5-12)8(9,10)11/h2-4,14H,5,12H2,1H3/t7-/m1/s1.
What are the key properties of (2S)-3-amino-1,1,1-trifluoro-2-(1-methylpyrrol-3-yl)propan-2-ol?
(2S)-3-amino-1,1,1-trifluoro-2-(1-methylpyrrol-3-yl)propan-2-ol has a molecular weight of 208.18 g/mol, XLogP of 0.73, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-amino-1,1,1-trifluoro-2-(1-methylpyrrol-3-yl)propan-2-ol is sourced from PubChem (CID 51922092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).