C15H16ClN3O6S2 — CID 51923138
(3R)-6-chloro-3-(2,3-dimethoxyphenyl)-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide (PubChem CID 51923138) has the molecular formula C15H16ClN3O6S2 and a molecular weight of 433.90 g/mol. Its IUPAC name is (3R)-6-chloro-3-(2,3-dimethoxyphenyl)-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide.
| Compound Name | (3R)-6-chloro-3-(2,3-dimethoxyphenyl)-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide |
|---|---|
| PubChem CID | 51923138 |
| Molecular Formula | C15H16ClN3O6S2 |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | (3R)-6-chloro-3-(2,3-dimethoxyphenyl)-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide |
| SMILES | COc1cccc([C@@H]2Nc3cc(Cl)c(S(N)(=O)=O)cc3S(=O)(=O)N2)c1OC |
| InChI | InChI=1S/C15H16ClN3O6S2/c1-24-11-5-3-4-8(14(11)25-2)15-18-10-6-9(16)12(26(17,20)21)7-13(10)27(22,23)19-15/h3-7,15,18-19H,1-2H3,(H2,17,20,21)/t15-/m1/s1 |
| InChIKey | CYHPEICRNQVRSB-OAHLLOKOSA-N |
| XLogP | 1.41 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |