About 1-cyclopropylethanamine
1-cyclopropylethanamine (PubChem CID 519239) has the molecular formula C5H11N
and a molecular weight of 85.15 g/mol. Its IUPAC name is 1-cyclopropylethanamine.
Molecular Properties
| Compound Name | 1-cyclopropylethanamine |
| PubChem CID | 519239 |
| Molecular Formula | C5H11N |
| Molecular Weight | 85.15 g/mol |
| Exact Mass | 85.09 |
| IUPAC Name | 1-cyclopropylethanamine |
| SMILES | CC(N)C1CC1 |
| InChI | InChI=1S/C5H11N/c1-4(6)5-2-3-5/h4-5H,2-3,6H2,1H3 |
| InChIKey | IXCXVGWKYIDNOS-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 85.15 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopropylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropylethanamine?
The IUPAC name of 1-cyclopropylethanamine (CID 519239) is 1-cyclopropylethanamine.
What is the SMILES notation for 1-cyclopropylethanamine?
The canonical SMILES for 1-cyclopropylethanamine is CC(N)C1CC1.
What is the InChIKey of 1-cyclopropylethanamine?
The InChIKey is IXCXVGWKYIDNOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N/c1-4(6)5-2-3-5/h4-5H,2-3,6H2,1H3.
What are the key properties of 1-cyclopropylethanamine?
1-cyclopropylethanamine has a molecular weight of 85.15 g/mol, XLogP of 0.74, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropylethanamine is sourced from PubChem (CID 519239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).