C28H22F4N2O5S — CID 5192473
[[2,2,2-trifluoro-1-[1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrol-3-yl]ethylidene]amino] 3-methoxybenzoate (PubChem CID 5192473) has the molecular formula C28H22F4N2O5S and a molecular weight of 574.55 g/mol. Its IUPAC name is [[2,2,2-trifluoro-1-[1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrol-3-yl]ethylidene]amino] 3-methoxybenzoate.
| Compound Name | [[2,2,2-trifluoro-1-[1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrol-3-yl]ethylidene]amino] 3-methoxybenzoate |
|---|---|
| PubChem CID | 5192473 |
| Molecular Formula | C28H22F4N2O5S |
| Molecular Weight | 574.55 g/mol |
| Exact Mass | 574.12 |
| IUPAC Name | [[2,2,2-trifluoro-1-[1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)pyrrol-3-yl]ethylidene]amino] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)ON=C(c2cc(-c3ccc(S(C)(=O)=O)cc3)n(-c3ccc(F)cc3)c2C)C(F)(F)F)c1 |
| InChI | InChI=1S/C28H22F4N2O5S/c1-17-24(26(28(30,31)32)33-39-27(35)19-5-4-6-22(15-19)38-2)16-25(34(17)21-11-9-20(29)10-12-21)18-7-13-23(14-8-18)40(3,36)37/h4-16H,1-3H3 |
| InChIKey | XXFCFHBFDAFKON-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.55 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|