C20H27NO4 — CID 51926303
propan-2-yl (3S)-3-[[(1R)-cyclohex-3-ene-1-carbonyl]amino]-3-(4-methoxyphenyl)propanoate (PubChem CID 51926303) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is propan-2-yl (3S)-3-[[(1R)-cyclohex-3-ene-1-carbonyl]amino]-3-(4-methoxyphenyl)propanoate.
| Compound Name | propan-2-yl (3S)-3-[[(1R)-cyclohex-3-ene-1-carbonyl]amino]-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 51926303 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | propan-2-yl (3S)-3-[[(1R)-cyclohex-3-ene-1-carbonyl]amino]-3-(4-methoxyphenyl)propanoate |
| SMILES | COc1ccc([C@H](CC(=O)OC(C)C)NC(=O)[C@H]2CC=CCC2)cc1 |
| InChI | InChI=1S/C20H27NO4/c1-14(2)25-19(22)13-18(15-9-11-17(24-3)12-10-15)21-20(23)16-7-5-4-6-8-16/h4-5,9-12,14,16,18H,6-8,13H2,1-3H3,(H,21,23)/t16-,18-/m0/s1 |
| InChIKey | UVTORMNCQWSGAS-WMZOPIPTSA-N |
| XLogP | 3.55 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|