C20H20N2O3S — CID 51926728
(2R)-N-(5-methyl-1,2-oxazol-3-yl)-2-(2-phenoxyethylsulfanyl)-2-phenylacetamide (PubChem CID 51926728) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is (2R)-N-(5-methyl-1,2-oxazol-3-yl)-2-(2-phenoxyethylsulfanyl)-2-phenylacetamide.
| Compound Name | (2R)-N-(5-methyl-1,2-oxazol-3-yl)-2-(2-phenoxyethylsulfanyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 51926728 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | (2R)-N-(5-methyl-1,2-oxazol-3-yl)-2-(2-phenoxyethylsulfanyl)-2-phenylacetamide |
| SMILES | Cc1cc(NC(=O)[C@H](SCCOc2ccccc2)c2ccccc2)no1 |
| InChI | InChI=1S/C20H20N2O3S/c1-15-14-18(22-25-15)21-20(23)19(16-8-4-2-5-9-16)26-13-12-24-17-10-6-3-7-11-17/h2-11,14,19H,12-13H2,1H3,(H,21,22,23)/t19-/m1/s1 |
| InChIKey | NZXLAUOSKLATOY-LJQANCHMSA-N |
| XLogP | 4.48 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|