C21H25N3O2S2 — CID 51927089
(3S,7aS)-3-[4-(1-benzothiophen-3-ylmethyl)piperazine-1-carbonyl]-7a-methyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one (PubChem CID 51927089) has the molecular formula C21H25N3O2S2 and a molecular weight of 415.58 g/mol. Its IUPAC name is (3S,7aS)-3-[4-(1-benzothiophen-3-ylmethyl)piperazine-1-carbonyl]-7a-methyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one.
| Compound Name | (3S,7aS)-3-[4-(1-benzothiophen-3-ylmethyl)piperazine-1-carbonyl]-7a-methyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one |
|---|---|
| PubChem CID | 51927089 |
| Molecular Formula | C21H25N3O2S2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | (3S,7aS)-3-[4-(1-benzothiophen-3-ylmethyl)piperazine-1-carbonyl]-7a-methyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one |
| SMILES | C[C@]12CCC(=O)N1[C@@H](C(=O)N1CCN(Cc3csc4ccccc34)CC1)CS2 |
| InChI | InChI=1S/C21H25N3O2S2/c1-21-7-6-19(25)24(21)17(14-28-21)20(26)23-10-8-22(9-11-23)12-15-13-27-18-5-3-2-4-16(15)18/h2-5,13,17H,6-12,14H2,1H3/t17-,21+/m1/s1 |
| InChIKey | VBAUWIYDLOWASR-UTKZUKDTSA-N |
| XLogP | 3.00 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |