C11H14F3N3OS — CID 51929053
(4-ethylthiadiazol-5-yl)-[(3R)-3-(trifluoromethyl)piperidin-1-yl]methanone (PubChem CID 51929053) has the molecular formula C11H14F3N3OS and a molecular weight of 293.31 g/mol. Its IUPAC name is (4-ethylthiadiazol-5-yl)-[(3R)-3-(trifluoromethyl)piperidin-1-yl]methanone.
| Compound Name | (4-ethylthiadiazol-5-yl)-[(3R)-3-(trifluoromethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 51929053 |
| Molecular Formula | C11H14F3N3OS |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | (4-ethylthiadiazol-5-yl)-[(3R)-3-(trifluoromethyl)piperidin-1-yl]methanone |
| SMILES | CCc1nnsc1C(=O)N1CCC[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C11H14F3N3OS/c1-2-8-9(19-16-15-8)10(18)17-5-3-4-7(6-17)11(12,13)14/h7H,2-6H2,1H3/t7-/m1/s1 |
| InChIKey | FVWROQIMOKLKFY-SSDOTTSWSA-N |
| XLogP | 2.52 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |