About 5-(4-methoxyphenyl)-7-(3-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine
5-(4-methoxyphenyl)-7-(3-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine (PubChem CID 5192991) has the molecular formula C18H17N5O
and a molecular weight of 319.37 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-7-(3-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 5-(4-methoxyphenyl)-7-(3-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine |
| PubChem CID | 5192991 |
| Molecular Formula | C18H17N5O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 5-(4-methoxyphenyl)-7-(3-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine |
| SMILES | COc1ccc(C2=CC(c3cccc(C)c3)n3nnnc3N2)cc1 |
| InChI | InChI=1S/C18H17N5O/c1-12-4-3-5-14(10-12)17-11-16(19-18-20-21-22-23(17)18)13-6-8-15(24-2)9-7-13/h3-11,17H,1-2H3,(H,19,20,22) |
| InChIKey | KFFKKKTWUOTRAK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(4-methoxyphenyl)-7-(3-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methoxyphenyl)-7-(3-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine?
The IUPAC name of 5-(4-methoxyphenyl)-7-(3-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine (CID 5192991) is 5-(4-methoxyphenyl)-7-(3-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 5-(4-methoxyphenyl)-7-(3-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine?
The canonical SMILES for 5-(4-methoxyphenyl)-7-(3-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine is COc1ccc(C2=CC(c3cccc(C)c3)n3nnnc3N2)cc1.
What is the InChIKey of 5-(4-methoxyphenyl)-7-(3-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine?
The InChIKey is KFFKKKTWUOTRAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N5O/c1-12-4-3-5-14(10-12)17-11-16(19-18-20-21-22-23(17)18)13-6-8-15(24-2)9-7-13/h3-11,17H,1-2H3,(H,19,20,22).
What are the key properties of 5-(4-methoxyphenyl)-7-(3-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine?
5-(4-methoxyphenyl)-7-(3-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine has a molecular weight of 319.37 g/mol, XLogP of 3.05, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methoxyphenyl)-7-(3-methylphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 5192991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).