C22H25NO4 — CID 51930939
1-[(2S)-2-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]-4-phenylbutane-1,4-dione (PubChem CID 51930939) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is 1-[(2S)-2-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]-4-phenylbutane-1,4-dione.
| Compound Name | 1-[(2S)-2-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]-4-phenylbutane-1,4-dione |
|---|---|
| PubChem CID | 51930939 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 1-[(2S)-2-(3,4-dimethoxyphenyl)pyrrolidin-1-yl]-4-phenylbutane-1,4-dione |
| SMILES | COc1ccc([C@@H]2CCCN2C(=O)CCC(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C22H25NO4/c1-26-20-12-10-17(15-21(20)27-2)18-9-6-14-23(18)22(25)13-11-19(24)16-7-4-3-5-8-16/h3-5,7-8,10,12,15,18H,6,9,11,13-14H2,1-2H3/t18-/m0/s1 |
| InChIKey | CAXRERODVHOLDS-SFHVURJKSA-N |
| XLogP | 4.03 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |