C18H18F4N2O — CID 51932634
(2R)-N-(2-fluorophenyl)-2-[methyl-[[2-(trifluoromethyl)phenyl]methyl]amino]propanamide (PubChem CID 51932634) has the molecular formula C18H18F4N2O and a molecular weight of 354.35 g/mol. Its IUPAC name is (2R)-N-(2-fluorophenyl)-2-[methyl-[[2-(trifluoromethyl)phenyl]methyl]amino]propanamide.
| Compound Name | (2R)-N-(2-fluorophenyl)-2-[methyl-[[2-(trifluoromethyl)phenyl]methyl]amino]propanamide |
|---|---|
| PubChem CID | 51932634 |
| Molecular Formula | C18H18F4N2O |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | (2R)-N-(2-fluorophenyl)-2-[methyl-[[2-(trifluoromethyl)phenyl]methyl]amino]propanamide |
| SMILES | C[C@H](C(=O)Nc1ccccc1F)N(C)Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H18F4N2O/c1-12(17(25)23-16-10-6-5-9-15(16)19)24(2)11-13-7-3-4-8-14(13)18(20,21)22/h3-10,12H,11H2,1-2H3,(H,23,25)/t12-/m1/s1 |
| InChIKey | SKXPDPVXGYEOQW-GFCCVEGCSA-N |
| XLogP | 4.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |