C18H23FN2O3 — CID 51933280
3-[(2R)-2-(2-fluorophenyl)-2-hydroxyethyl]-1,3-diazaspiro[4.7]dodecane-2,4-dione (PubChem CID 51933280) has the molecular formula C18H23FN2O3 and a molecular weight of 334.39 g/mol. Its IUPAC name is 3-[(2R)-2-(2-fluorophenyl)-2-hydroxyethyl]-1,3-diazaspiro[4.7]dodecane-2,4-dione.
| Compound Name | 3-[(2R)-2-(2-fluorophenyl)-2-hydroxyethyl]-1,3-diazaspiro[4.7]dodecane-2,4-dione |
|---|---|
| PubChem CID | 51933280 |
| Molecular Formula | C18H23FN2O3 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 3-[(2R)-2-(2-fluorophenyl)-2-hydroxyethyl]-1,3-diazaspiro[4.7]dodecane-2,4-dione |
| SMILES | O=C1NC2(CCCCCCC2)C(=O)N1C[C@H](O)c1ccccc1F |
| InChI | InChI=1S/C18H23FN2O3/c19-14-9-5-4-8-13(14)15(22)12-21-16(23)18(20-17(21)24)10-6-2-1-3-7-11-18/h4-5,8-9,15,22H,1-3,6-7,10-12H2,(H,20,24)/t15-/m0/s1 |
| InChIKey | FNRBWFAGLNQOJH-HNNXBMFYSA-N |
| XLogP | 2.89 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|