C16H22O3Si3 — CID 519340
2,2,4,4-tetramethyl-6,6-diphenyl-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 519340) has the molecular formula C16H22O3Si3 and a molecular weight of 346.61 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-6,6-diphenyl-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2,2,4,4-tetramethyl-6,6-diphenyl-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 519340 |
| Molecular Formula | C16H22O3Si3 |
| Molecular Weight | 346.61 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 2,2,4,4-tetramethyl-6,6-diphenyl-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si](c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C16H22O3Si3/c1-20(2)17-21(3,4)19-22(18-20,15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14H,1-4H3 |
| InChIKey | OGDLFRPDSKIBRZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.61 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|