methyl (2S)-2-(2,6-dimethylpyrimidin-4-yl)sulfanylpropanoate

C10H14N2O2S — CID 51934014

IUPACmethyl (2S)-2-(2,6-dimethylpyrimidin-4-yl)sulfanylpropanoate
SMILESCOC(=O)[C@H](C)Sc1cc(C)nc(C)n1
InChIInChI=1S/C10H14N2O2S/c1-6-5-9(12-8(3)11-6)15-7(2)10(13)14-4/h5,7H,1-4H3/t7-/m0/s1
InChIKeyFWTUYBJELZEXJM-ZETCQYMHSA-N
MW226.30 g/mol
LogP1.75
Rot. Bonds3

About methyl (2S)-2-(2,6-dimethylpyrimidin-4-yl)sulfanylpropanoate

methyl (2S)-2-(2,6-dimethylpyrimidin-4-yl)sulfanylpropanoate (PubChem CID 51934014) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is methyl (2S)-2-(2,6-dimethylpyrimidin-4-yl)sulfanylpropanoate.

Molecular Properties

Compound Namemethyl (2S)-2-(2,6-dimethylpyrimidin-4-yl)sulfanylpropanoate
PubChem CID51934014
Molecular FormulaC10H14N2O2S
Molecular Weight226.30 g/mol
Exact Mass226.08
IUPAC Namemethyl (2S)-2-(2,6-dimethylpyrimidin-4-yl)sulfanylpropanoate
SMILESCOC(=O)[C@H](C)Sc1cc(C)nc(C)n1
InChIInChI=1S/C10H14N2O2S/c1-6-5-9(12-8(3)11-6)15-7(2)10(13)14-4/h5,7H,1-4H3/t7-/m0/s1
InChIKeyFWTUYBJELZEXJM-ZETCQYMHSA-N
XLogP1.75
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.30
LogP ≤ 51.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl (2S)-2-(2,6-dimethylpyrimidin-4-yl)sulfanylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S)-2-(2,6-dimethylpyrimidin-4-yl)sulfanylpropanoate?
The IUPAC name of methyl (2S)-2-(2,6-dimethylpyrimidin-4-yl)sulfanylpropanoate (CID 51934014) is methyl (2S)-2-(2,6-dimethylpyrimidin-4-yl)sulfanylpropanoate.
What is the SMILES notation for methyl (2S)-2-(2,6-dimethylpyrimidin-4-yl)sulfanylpropanoate?
The canonical SMILES for methyl (2S)-2-(2,6-dimethylpyrimidin-4-yl)sulfanylpropanoate is COC(=O)[C@H](C)Sc1cc(C)nc(C)n1.
What is the InChIKey of methyl (2S)-2-(2,6-dimethylpyrimidin-4-yl)sulfanylpropanoate?
The InChIKey is FWTUYBJELZEXJM-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H14N2O2S/c1-6-5-9(12-8(3)11-6)15-7(2)10(13)14-4/h5,7H,1-4H3/t7-/m0/s1.
What are the key properties of methyl (2S)-2-(2,6-dimethylpyrimidin-4-yl)sulfanylpropanoate?
methyl (2S)-2-(2,6-dimethylpyrimidin-4-yl)sulfanylpropanoate has a molecular weight of 226.30 g/mol, XLogP of 1.75, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-(2,6-dimethylpyrimidin-4-yl)sulfanylpropanoate is sourced from PubChem (CID 51934014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).