C19H20N4O2 — CID 51934347
(3S)-5-N-ethyl-5-N,2-diphenyl-3,4-dihydropyrazole-3,5-dicarboxamide (PubChem CID 51934347) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is (3S)-5-N-ethyl-5-N,2-diphenyl-3,4-dihydropyrazole-3,5-dicarboxamide.
| Compound Name | (3S)-5-N-ethyl-5-N,2-diphenyl-3,4-dihydropyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 51934347 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (3S)-5-N-ethyl-5-N,2-diphenyl-3,4-dihydropyrazole-3,5-dicarboxamide |
| SMILES | CCN(C(=O)C1=NN(c2ccccc2)[C@H](C(N)=O)C1)c1ccccc1 |
| InChI | InChI=1S/C19H20N4O2/c1-2-22(14-9-5-3-6-10-14)19(25)16-13-17(18(20)24)23(21-16)15-11-7-4-8-12-15/h3-12,17H,2,13H2,1H3,(H2,20,24)/t17-/m0/s1 |
| InChIKey | GWXUBMLTPGERIZ-KRWDZBQOSA-N |
| XLogP | 2.16 |
| TPSA | 79.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |