C12H18F3NO2 — CID 51934430
(2S)-N-[4-(trifluoromethyl)cyclohexyl]oxolane-2-carboxamide (PubChem CID 51934430) has the molecular formula C12H18F3NO2 and a molecular weight of 265.27 g/mol. Its IUPAC name is (2S)-N-[4-(trifluoromethyl)cyclohexyl]oxolane-2-carboxamide.
| Compound Name | (2S)-N-[4-(trifluoromethyl)cyclohexyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 51934430 |
| Molecular Formula | C12H18F3NO2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (2S)-N-[4-(trifluoromethyl)cyclohexyl]oxolane-2-carboxamide |
| SMILES | O=C(NC1CCC(C(F)(F)F)CC1)[C@@H]1CCCO1 |
| InChI | InChI=1S/C12H18F3NO2/c13-12(14,15)8-3-5-9(6-4-8)16-11(17)10-2-1-7-18-10/h8-10H,1-7H2,(H,16,17)/t8?,9?,10-/m0/s1 |
| InChIKey | HKOPJSMXSLQVLM-RTBKNWGFSA-N |
| XLogP | 2.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |