C12H16N2O2 — CID 51938440
3-[(2S)-oxolan-2-yl]-N-pyridin-2-ylpropanamide (PubChem CID 51938440) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 3-[(2S)-oxolan-2-yl]-N-pyridin-2-ylpropanamide.
| Compound Name | 3-[(2S)-oxolan-2-yl]-N-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 51938440 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 3-[(2S)-oxolan-2-yl]-N-pyridin-2-ylpropanamide |
| SMILES | O=C(CC[C@@H]1CCCO1)Nc1ccccn1 |
| InChI | InChI=1S/C12H16N2O2/c15-12(7-6-10-4-3-9-16-10)14-11-5-1-2-8-13-11/h1-2,5,8,10H,3-4,6-7,9H2,(H,13,14,15)/t10-/m0/s1 |
| InChIKey | NPVSKWSZJIZNQK-JTQLQIEISA-N |
| XLogP | 1.98 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |